0

Subjects>Hobbies>Collecting Hobbies

What is the chemical formula of superphosphate?

Anonymous

∙ 15y ago

Updated: 10/24/2022

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)

Wiki User

∙ 15y ago

What else can I help you with?

Related Questions

Chemical formula of phosphorite used in superphosphate fertilizer?

The chemical formula of phosphorite used in superphosphate fertilizer is generally Ca(H2PO4)2, which is a type of phosphate rock. Superphosphate fertilizer is created by treating phosphorite with sulfuric acid to form water-soluble phosphate compounds that can be easily taken up by plants.

Is superphosphate synthetic or processed?

Phosphates are natural minerals; but phosphatic fertilizers are products of the chemical industry.

What is The percentage of phosphrous in superphosphate?

Superphosphate typically contains between 16-20% phosphorus.

What are common forms of treated or processed phosphate compounds?

phosphoric acid, triple superphosphate, ammonium phosphate, and superphosphate

What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.

What is the chemical name for formula?

chemical formula

The chemical formula for glucose is?

The chemical formula for glucose is C6H12O6.

What is the chemical formula for a ribose?

the chemical formula for a ribose is C12H22O11.

What is the chemical formula of mannose?

The chemical formula of mannose is C6H12O6.

What is the chemical formula for CF?

The chemical formula for CF is carbon monofluoride.

What is the chemical formula for Fructos?

The chemical formula for Fructose is C6H12O6

What is the chemical formula for SnCl4?

The chemical formula for tin(IV) chloride is SnCl4.

Trending Questions

What is the saw looking thing on a submarine? Mike schmidt 1987 card number 657 card value? What is value of 1989 Victoria shilling? How much is a 1960 Kimball Piano worth? What is value of hunter pence autographed card? What does the large engraved S down the front of the lady mean on a Standing Liberty Quarter? 1999 estados unidos mexicanos coin gold and silver symbols 5 on it worth in the us? What is the value of a George III coin dated 1797 and how can you check what denomination it is? How much is a ten cent Japanese coin worth because I have one and I think it might be worth a pretty penny? What is the value of a quarter that appears to be a copper color and does not seem to have any silver coating on it at all? What sort of things come from Africa? Can a wife sign her husband signature and he not be there and have a notary stamp it? What is the current value of 57 troy oz of sterling silver? How much is one pound in Canadian currency? Are krugerrands valuable? Is Liz claiborne jewelry worth anything? What is the difference between deep silver vs silver plate or sterling? Was there ever a 1718 Farthing minted? What is a dei gratia 1813 ferdin vii SPANISH coin worth? How fast can a 2006 crf150 go?

Resources

Top Categories

Product

Company

Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.