0

Subjects>Hobbies>Collecting Hobbies

What is the chemical formula of superphosphate?

Anonymous

∙ 15y ago

Updated: 10/24/2022

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)

Wiki User

∙ 15y ago

What else can I help you with?

Related Questions

Chemical formula of phosphorite used in superphosphate fertilizer?

The chemical formula of phosphorite used in superphosphate fertilizer is generally Ca(H2PO4)2, which is a type of phosphate rock. Superphosphate fertilizer is created by treating phosphorite with sulfuric acid to form water-soluble phosphate compounds that can be easily taken up by plants.

Is superphosphate synthetic or processed?

Phosphates are natural minerals; but phosphatic fertilizers are products of the chemical industry.

What is The percentage of phosphrous in superphosphate?

Superphosphate typically contains between 16-20% phosphorus.

What are common forms of treated or processed phosphate compounds?

phosphoric acid, triple superphosphate, ammonium phosphate, and superphosphate

What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.

What is the chemical name for formula?

chemical formula

The chemical formula for glucose is?

The chemical formula for glucose is C6H12O6.

What is the chemical formula for a ribose?

the chemical formula for a ribose is C12H22O11.

What is the chemical formula of mannose?

The chemical formula of mannose is C6H12O6.

What is the chemical formula for CF?

The chemical formula for CF is carbon monofluoride.

What is the chemical formula for Fructos?

The chemical formula for Fructose is C6H12O6

What is the chemical formula for ethanal?

The chemical formula of ethanal (acetic aldehyde) is CH3CHO.

Trending Questions

How much is a Edward Hald 1946 fish graal Orrefors glass vase worth? Value for sir francis drake world map issued by Franklin Mint? What is the irregular noun of datum? What is the value of a silver piece made by Rogers Silver Co. Taunton MA which says quadruple on it and the number 408? What is the value of signed 1926 Yankees team baseball? What is the value of a 1991 Upper Deck Barry Bonds Pittsburgh Pirates card number 154? What is a hembrug 1917 rifle worth? What is the value of the Franklin Mint Domino Set? What does 060 mean on jewelry? What is the value of a tenth of a penny 1927 british West Africa coin? What is a 1973 Hank Aaron baseball card worth now in pawn value? How much is an old VCR worth? How many points does your credit score drop after a collection? Is the 2 cent stamp freedom to speak out worth anything? What is souvenir? How much is signed Peyton Manning card worth? What is old is gold? Where can one find how much antique brass is worth? What is the current value of an Australian blue Abel Tasman stamp? Is state quarters collector's map worth anything once filled?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com | Lunias Media Inc. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.