Ca(H2PO4)2(s)+2CaSO4.2H2O(s)
Wiki User
∙ 14y agoThe chemical formula of phosphorite used in superphosphate fertilizer is generally Ca(H2PO4)2, which is a type of phosphate rock. Superphosphate fertilizer is created by treating phosphorite with sulfuric acid to form water-soluble phosphate compounds that can be easily taken up by plants.
Phosphates are natural minerals; but phosphatic fertilizers are products of the chemical industry.
Superphosphate typically contains between 16-20% phosphorus.
phosphoric acid, triple superphosphate, ammonium phosphate, and superphosphate
Energy has no chemical formula as it is not a chemical.
chemical formula
The chemical formula for Fructose is C6H12O6
the chemical formula for a ribose is C12H22O11.
The chemical formula for glucose is C6H12O6.
The chemical formula for CF is carbon monofluoride.
The chemical formula of mannose is C6H12O6.
The chemical formula for tin(IV) chloride is SnCl4.