0
What else can I help you with?
Related Questions
Why was leeds so popular in the 1900s?
Cos its bkoody brilliant! Best city in england easy. Leeds Leeds Leeds
Why is mark so great?
Cos he is amazing!
Who is better evil befall or spiral Capricorn?
i will say spiral capricorn cos it has amazing attack
How does the big bang theory support the conculsion that the universe is expanding?
Cos it is an amazing tv show
Is it bad if you don't oragasm?
well it is a pretty bad loss for you cos orgasms are freaking amazing
Is Justin bieber have more fans than jaden smith?
yh cos Justin has been around for longer and has more songs
How is twilight affecting teenagers?
because its good, well i should say AMAZING, y? dont u like it? cos... =D
What is cos square?
Cos times Cos
Is cos squared x the same as cos x squared?
No. Cos squared x is not the same as cos x squared. Cos squared x means cos (x) times cos (x) Cos x squared means cos (x squared)
Cos plus cos plus cos?
3cos
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
cos i?
cos i
Trending Questions
How do you say eggs in Latin?
Where can I go to get some information on best mbas?
Did Randy Orton ever cheat on Samantha?
What are the release dates for In Our Lives - 1980 The Case of Cain and Mable 8-4?
How much is a cubic meter of soil worth?
What is 66-1?
What structure manufactures bile?
What is 315 rounded to the nearest hundred?
Does oxygen have gravity in it?
Can you use an Xbox 360 web browser without windows media center?
What is the first prime number greater than 100?
Who is with male model with shyla Lopez in aaja piya tohe pyaar doon?
Driving time between Geneva and zurich?
Why does giant flying squirrel have featherless skin between front and back legs?
Is earth is danger of being pulled into a black hole?
How do you store petrol?
What is the best frozen cheesecake?
Definition of the medulla?
What is 38 rounded to the nearest whole number?
What is Steve Vai's favorite mode?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.