Ca(H2PO4)2(s)+2CaSO4.2H2O(s)
ca3[po4]2
Phosphates are natural minerals; but phosphatic fertilizers are products of the chemical industry.
7 - 9.5% P; 16 to 22% P2O5 this is the phosphorous content in superphosphate
phosphoric acid, triple superphosphate, ammonium phosphate, and superphosphate
Energy has no chemical formula as it is not a chemical.
chemical formula
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3
It is a chemical formula.
it has no chemical formula. it is a mixture. only compounds have a chemical formula.
The chemical formula of cysteine is HO2CCH(NH2)CH2SH.
H2O is 2 hydrogens plus 1 oxygen and that makes the chemical formula for water.